A2636012
Chloramine B Hydrate , >80.0%(T) , 127-52-6
Synonym(s):
Benzene chloramine;Chloramine B;Sodium (phenylsulfonyl)chloramide
CAS NO.：127-52-6
Empirical Formula: C6H5ClNNaO2S
Molecular Weight: 213.62
MDL number: MFCD00007545
EINECS: 204-847-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB40.00 | In Stock |
|
| 100G | RMB59.20 | In Stock |
|
| 500G | RMB221.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190°C |
| Boiling point: | 189℃[at 101 325 Pa] |
| Density | 1.484[at 20℃] |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | H2O: 0.1 g/mL, clear |
| pka | 1.88[at 20 ℃] |
| form | solid |
| Appearance | White to off-white Solid |
| Water Solubility | 0.1 g/mL |
| Merck | 14,2074 |
| BRN | 3599287 |
| InChI | InChI=1S/C6H5ClNO2S.Na/c7-8-11(9,10)6-4-2-1-3-5-6;/h1-5H;/q-1;+1 |
| InChIKey | KDNCILYKSYKEFJ-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)S(=O)(=O)N(Cl)[Na] |
| LogP | 0.14 at 26℃ |
| EPA Substance Registry System | Chloramine B (127-52-6) |
Description and Uses
Used in investigations of the toxicity response of electroactive microbial biofilms
Catalyst for rearrangement of aziridinofullerenes to azafulleroids
Oxidizing agent for polymerization of thiophenol, synthesis of o-aminobenzenesulfonic acids and ciproflaxin
Decontaminant for mustard
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H314-H334 |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 22-31-34-42-2 |
| Safety Statements | 7-22-26-36/37/39-45 |
| RIDADR | UN 3263 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DA9300000 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29350090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Resp. Sens. 1 Skin Corr. 1B |
| Hazardous Substances Data | 127-52-6(Hazardous Substances Data) |
