A2636912
2-Chloro-6-methylisonicotinic Acid , >98.0%(HPLC) , 25462-85-5
Synonym(s):
2-Chloro-6-methylisonicotinic acid
CAS NO.：25462-85-5
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00052830
EINECS: 626-878-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB51.12 | In Stock |
|
| 5G | RMB147.20 | In Stock |
|
| 25G | RMB443.20 | In Stock |
|
| 100G | RMB1339.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-212 °C (dec.) (lit.) |
| Boiling point: | 399.0±37.0 °C(Predicted) |
| Density | 1.390±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.07±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 122809 |
| InChI | InChI=1S/C7H6ClNO2/c1-4-2-5(7(10)11)3-6(8)9-4/h2-3H,1H3,(H,10,11) |
| InChIKey | ZGZMEKHQIZSZOH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 25462-85-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-43-20/21/22 |
| Safety Statements | 26-36/37/39-22-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
