A2638112
2-Chloro-1,4-naphthoquinone , >98.0% , 1010-60-2
CAS NO.：1010-60-2
Empirical Formula: C10H5ClO2
Molecular Weight: 192.6
MDL number: MFCD00029187
EINECS: 213-776-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB155.20 | In Stock |
|
| 500g | RMB756.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-109°C |
| Boiling point: | 308.0±42.0 °C(Predicted) |
| Density | 1.42±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly) |
| form | Solid |
| color | Yellow to Dark Yellow |
| λmax | 333nm(Hexane)(lit.) |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C10H5ClO2/c11-8-5-9(12)6-3-1-2-4-7(6)10(8)13/h1-5H |
| InChIKey | CCTJHVLTAJTPBV-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C=C1Cl |
| CAS DataBase Reference | 1010-60-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-1,4-naphthoquinone(1010-60-2) |
Description and Uses
A substituted naphthoquinones as insecticides and acaricides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| RTECS | QL7450000 |
| HS Code | 2914698090 |
