A3192512
2,3-Dichloro-1,4-naphthoquinone , Analysis standard , 117-80-6
Synonym(s):
2,3-Dichloro-1,4-naphthoquinone;Dichlon
CAS NO.:117-80-6
Empirical Formula: C10H4Cl2O2
Molecular Weight: 227.04
MDL number: MFCD00001677
EINECS: 204-210-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-197 °C (lit.) |
| Boiling point: | 275 °C (2 mmHg) |
| Density | 1.4057 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.5410 (estimate) |
| Flash point: | 275°C/2mm |
| storage temp. | Store below +30°C. |
| form | Fine Crystalline Powder |
| color | Yellow |
| Water Solubility | 0.008 g/L |
| Merck | 14,3045 |
| BRN | 1073511 |
| InChI | 1S/C10H4Cl2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H |
| InChIKey | SVPKNMBRVBMTLB-UHFFFAOYSA-N |
| SMILES | ClC1=C(Cl)C(=O)c2ccccc2C1=O |
| LogP | 2.9 at 23℃ |
| CAS DataBase Reference | 117-80-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Naphthalenedione, 2,3-dichloro-(117-80-6) |
| EPA Substance Registry System | Dichlone (117-80-6) |
Description and Uses
Use in textiles, as organic catalyst, as chemical intermediate, as additive in dye binders. Also used as an important catalyst to produce 3,3-dichlorobenzene.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H410 |
| Precautionary statements | P264-P270-P273-P301+P310-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36/38-50/53 |
| Safety Statements | 26-60-61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | QL7525000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29147090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 117-80-6(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 1300 mg/kg (Bailey, White) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





