A3443912
2,3-Dichloro-5,8-dihydroxy-1,4-naphthoquinone , >97.0%(HPLC)(T) , 14918-69-5
Synonym(s):
2,3-Dichloro-5,8-dihydroxynaphtho-1,4-quinone
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB223.20 | In Stock |
|
| 1G | RMB556.80 | In Stock |
|
| 5G | RMB1949.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197-199 °C (lit.) |
| Boiling point: | 366.21°C (rough estimate) |
| Density | 1.5311 (rough estimate) |
| refractive index | 1.5110 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly) |
| form | powder to crystal |
| pka | 5.84±0.20(Predicted) |
| color | Orange to Brown to Dark red |
| InChI | 1S/C10H4Cl2O4/c11-7-8(12)10(16)6-4(14)2-1-3(13)5(6)9(7)15/h1-2,13-14H |
| InChIKey | UVESKDKGJSABKP-UHFFFAOYSA-N |
| SMILES | Oc1ccc(O)c2C(=O)C(Cl)=C(Cl)C(=O)c12 |
| CAS DataBase Reference | 14918-69-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2914.79.4000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
