A2638712
Cyclohexyl Butyrate , >98.0%(GC) , 1551-44-6
CAS NO.:1551-44-6
Empirical Formula: C10H18O2
Molecular Weight: 170.25
MDL number: MFCD00046354
EINECS: 216-290-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB76.00 | In Stock |
|
| 50G | RMB135.20 | In Stock |
|
| 100G | RMB239.20 | In Stock |
|
| 250G | RMB471.20 | In Stock |
|
| 500G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 202-203 °C/700 mmHg (lit.) |
| Density | 0.943 g/mL at 25 °C (lit.) |
| FEMA | 2351 | CYCLOHEXYL BUTYRATE |
| refractive index | n |
| Flash point: | 173 °F |
| Odor | at 100.00 %. fruity apple pineapple floral |
| Odor Type | fruity |
| biological source | synthetic |
| JECFA Number | 1094 |
| BRN | 2083414 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | InChI=1S/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
| InChIKey | VZHUBBUZNIULNM-UHFFFAOYSA-N |
| SMILES | C(OC1CCCCC1)(=O)CCC |
| LogP | 3.30 |
| CAS DataBase Reference | 1551-44-6(CAS DataBase Reference) |
| EPA Substance Registry System | Butanoic acid, cyclohexyl ester (1551-44-6) |
Description and Uses
Cyclohexyl Butyrate is a synthetic flavoring agent that is a stable, colorless liquid of fruity odor. it should be stored in glass, tin, or resin-lined containers. it is used in pineapple, apricot, banana, and berry flavor with applications in beverages, ice cream, and candy at 4–9 ppm.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H227-H303 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501-P210e-P280a-P370+P378a-P501a |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | ES8915000 |
| TSCA | TSCA listed |
| HS Code | 2915.60.5000 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | guinea pig,LD50,skin,> 5gm/kg (5000mg/kg),Food and Chemical Toxicology. Vol. 26, Pg. 293, 1988. |







