PRODUCT Properties
| Melting point: | 222° |
| alpha | D20 +34.5° (c = 5.09 in CHCl3) |
| Boiling point: | 586.3±50.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| optical activity | +34.520 (c 5.09, CHCl3) |
| Cosmetics Ingredients Functions | DENATURANT |
| InChIKey | IOSXSVZRTUWBHC-LBTVDEKVSA-N |
| SMILES | C1(=O)[C@]2([C@](C[C@@]3([C@@]4([C@@]2(C(=O)C(OC)=C(C)[C@]4([H])CC(=O)O3)[H])C)[H])([H])[C@H](C)C=C1OC)C |
| LogP | 2.220 (est) |
| EPA Substance Registry System | Picrasa-2,12-diene-1,11,16-trione, 2,12-dimethoxy- (76-78-8) |
Description and Uses
Quassin is a naturally occurring extract from quassia trees and is used in traditional chinese medicine for its antiulcerogenic properties. Quassin have also been used as an additive in soft drinks.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H332-H319-H312 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P280-P302+P352-P312-P322-P363-P501-P261-P271-P304+P340-P312-P264-P280-P305+P351+P338-P337+P313P |







