A2641412
1-Chloro-2,4-difluorobenzene , >98.0%(GC) , 1435-44-5
CAS NO.:1435-44-5
Empirical Formula: C6H3ClF2
Molecular Weight: 148.54
MDL number: MFCD00042569
EINECS: 604-365-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB29.60 | In Stock |
|
| 10G | RMB47.20 | In Stock |
|
| 25G | RMB92.80 | In Stock |
|
| 50G | RMB141.60 | In Stock |
|
| 100G | RMB264.00 | In Stock |
|
| 250G | RMB630.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -26 °C |
| Boiling point: | 127 °C (lit.) |
| Density | 1.353 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 91 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.353 |
| BRN | 2081077 |
| InChI | InChI=1S/C6H3ClF2/c7-5-2-1-4(8)3-6(5)9/h1-3H |
| InChIKey | AJCSNHQKXUSMMY-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(F)C=C1F |
| CAS DataBase Reference | 1435-44-5(CAS DataBase Reference) |
Description and Uses
1-Chloro-2,4-difluorobenzene was used in the preparation of series of benzonorbornadienes. It was also used in the preparation of difluoroarenes.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







