A7641312
Teflubenzuron , Analysis of standard products, 99%(HPLC) , 83121-18-0
CAS NO.:83121-18-0
Empirical Formula: C14H6Cl2F4N2O2
Molecular Weight: 381.11
MDL number: MFCD00068254
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB318.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221-224° |
| Density | 1.646±0.06 g/cm3(Predicted) |
| vapor pressure | 8 x 10 -7 mPa (20 °C) |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| Water Solubility | 0.019 mg l-1 (23 °C) |
| pka | 8.16±0.46(Predicted) |
| color | White to Off-White |
| Merck | 13,9190 |
| BRN | 8229925 |
| Major Application | agriculture environmental |
| InChI | 1S/C14H6Cl2F4N2O2/c15-5-4-8(12(20)10(16)11(5)19)21-14(24)22-13(23)9-6(17)2-1-3-7(9)18/h1-4H,(H2,21,22,23,24) |
| InChIKey | CJDWRQLODFKPEL-UHFFFAOYSA-N |
| SMILES | Fc1cccc(F)c1C(=O)NC(=O)Nc2cc(Cl)c(F)c(Cl)c2F |
| LogP | 4.98 at 20℃ and pH4.7 |
| CAS DataBase Reference | 83121-18-0(CAS DataBase Reference) |
| EPA Substance Registry System | Teflubenzuron (83121-18-0) |
Description and Uses
Teflubenzuron is used for the control of Lepidoptera, Coleoptera, Diptera, Aleyrodidae, Hymenoptera, Psyllidae and Hemiptera larvae on vines, pome fruit, citrus, vegetables, soyabeans, tobacco and cotton. It also controls fly and mosquito larvae and immature stages of locusts.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H373-H410 |
| Precautionary statements | P260-P273-P314-P391-P501 |
| target organs | Liver |
| PPE | Eyeshields, Gloves, type N95 (US) |
| RIDADR | 3077 |
| WGK Germany | 2 |
| RTECS | CV3459590 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| Toxicity | LD50 orally in rats: >5000 mg/kg (Becher) |







