A2658812
4-<WBR>(Chlorosulfonyl)<WBR>benzoic acid , 96% , 10130-89-9
CAS NO.:10130-89-9
Empirical Formula: C7H5ClO4S
Molecular Weight: 220.63
MDL number: MFCD00007448
EINECS: 233-367-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.00 | In Stock |
|
| 5G | RMB144.80 | In Stock |
|
| 10g | RMB287.20 | In Stock |
|
| 25G | RMB644.80 | In Stock |
|
| 100g | RMB2223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230 °C |
| Boiling point: | 379.1±25.0 °C(Predicted) |
| Density | 1.5116 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in DMSO, Methanol |
| pka | 3.09±0.10(Predicted) |
| form | Powder |
| color | Off-white to beige |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C7H5ClO4S/c8-13(11,12)6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | PTCSSXYPZOFISK-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(cc1)S(Cl)(=O)=O |
| CAS DataBase Reference | 10130-89-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-(chlorosulfonyl)- (10130-89-9) |
Description and Uses
4-(Chlorosulfonyl)benzoic acid was used in the preparation of polymer bound transfer hydrogenation catalyst and 4-(carboxymethyl-sulfamoyl)-benzoyladenosine. It was also used as a reagent in the sulfonation of γ-cyclodextrin.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-29-22 |
| Safety Statements | 8-45-36/37/39-26 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29173990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |



![4-([1,1'-Biphenyl]-2-ylcarboxamido)benzoicacid](https://img.chemicalbook.com/CAS2/GIF/168626-74-2.gif)


