A2665112
6-<WBR>Chloro-<WBR>2-<WBR>fluoro-<WBR>3-<WBR>methoxybenzaldehyde , 97% , 112641-64-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB351.20 | In Stock |
|
| 5g | RMB1007.20 | In Stock |
|
| 25g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-100℃ |
| Boiling point: | 264.9±35.0 °C(Predicted) |
| Density | 1.334±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C8H6ClFO2/c1-12-7-3-2-6(9)5(4-11)8(7)10/h2-4H,1H3 |
| InChIKey | OADUJQWBRPRPQX-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(Cl)C=CC(OC)=C1F |
Description and Uses
Used as solvents. They are used in intermediate steps for the production of paints, plastics, synthetic resins, and dyes. They are also used in the manufacture of perfumes, solvents, and flavorings.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2913000090 |
