A2681212
Chlorodiphenylsilane , 90% , 1631-83-0
Synonym(s):
Diphenylchlorosilane
CAS NO.:1631-83-0
Empirical Formula: C12H11ClSi
Molecular Weight: 218.75
MDL number: MFCD00045144
EINECS: 216-634-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB60.00 | In Stock |
|
| 5ML | RMB220.00 | In Stock |
|
| 25ML | RMB944.00 | In Stock |
|
| 100ml | RMB3184.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 143 °C10 mm Hg(lit.) |
| Density | 1.118 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store at room temperature |
| solubility | sol benzene, chloroform, carbon tetrachloride, and
ether. |
| Specific Gravity | 1.118 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 2937164 |
| InChI | 1S/C12H11ClSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | VTMOWGGHUAZESJ-UHFFFAOYSA-N |
| SMILES | [H][Si](Cl)(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 1631-83-0(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, chlorodiphenyl- (1631-83-0) |
Description and Uses
Chlorodiphenylsilane is used in Medicine field, electronics industry, polymer materials. It is used in reduction of alcohols.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 1 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Excepted Quantities | Not Permitted as Excepted Quantity |







