Diphenylsilanediol , >98.0% , 947-42-2
CAS NO.:947-42-2
Empirical Formula: C12H12O2Si
Molecular Weight: 216.31
MDL number: MFCD00002101
EINECS: 213-427-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB52.00 | In Stock |
|
| 100G | RMB141.60 | In Stock |
|
| 500G | RMB526.40 | In Stock |
|
| 2.5kg | RMB2159.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 144-147 °C |
| Boiling point: | 353°C [760mmHg] |
| Density | 0.87 |
| vapor density | >1 (vs air) |
| vapor pressure | 0Pa at 25℃ |
| Flash point: | 129 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| pka | 12.06±0.53(Predicted) |
| color | white |
| Water Solubility | reacts |
| Sensitive | Air & Light Sensitive |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 2523445 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C12H12O2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | OLLFKUHHDPMQFR-UHFFFAOYSA-N |
| SMILES | O[Si](O)(c1ccccc1)c2ccccc2 |
| LogP | 2 at 20℃ |
| CAS DataBase Reference | 947-42-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenyl silanediol(947-42-2) |
| EPA Substance Registry System | Silanediol, diphenyl- (947-42-2) |
Description and Uses
Diphenylsilanediol is a chemical compound that is used as a catalyst. It can be produced by the reaction of diphenylsilane with sulfuric acid. This chemical has been shown to have high thermal and chemical stability, making it an ideal material for catalytic materials. Diphenylsilanediol has also been shown to be an efficient solid catalyst for synthesizing hydrocarbons from hydrogen fluoride and hydrochloric acid. The efficiency of this catalyst may be due to its ability to reduce the activation energy required for the reaction. Diphenylsilanediol is an important material used to manufacture silicone resins and rubbers. In addition, it is helpful as an additive for organopolysiloxanes that are convertible to the cured solid.
Diphenylsilanediol is used in Medicine field, electronics industry and polymer material.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H228 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F |
| Risk Statements | 11-10 |
| Safety Statements | 16-22-24/25-37-26 |
| RIDADR | UN 1325 4.1/PG 3 |
| WGK Germany | 1 |
| RTECS | VV3640000 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 1 |







