![5-<WBR>(4-<WBR>Chlorophenyl)<WBR>-<WBR>2,4-<WBR>dihydro-<WBR>[1,2,4]<WBR>-<WBR>triazole-<WBR>3-<WBR>thione](https://img.chemicalbook.com/CAS/GIF/26028-65-9.gif)
A2693212
5-<WBR>(4-<WBR>Chlorophenyl)<WBR>-<WBR>2,4-<WBR>dihydro-<WBR>[1,2,4]<WBR>-<WBR>triazole-<WBR>3-<WBR>thione , 97% , 26028-65-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB593.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 295-299 °C(lit.) |
| Boiling point: | 296.8±42.0 °C(Predicted) |
| Density | 1.55±0.1 g/cm3(Predicted) |
| pka | 8.21±0.20(Predicted) |
| form | solid |
| color | White to light yellow |
| InChI | InChI=1S/C8H6ClN3S/c9-6-3-1-5(2-4-6)7-10-8(13)12-11-7/h1-4H,(H2,10,11,12,13) |
| InChIKey | NHEHIODVWGKDFV-UHFFFAOYSA-N |
| SMILES | N1C(C2=CC=C(Cl)C=C2)=NC(=S)N1 |
Description and Uses
DCN1-UBC12-IN-4 (compound 5p) is an inhibitor of DCN1-UBC12, with an IC50 greater than 10000 nM, and it exhibits anti-tumor activity[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
