A2695512
3-Chloroindazole , 97% , 29110-74-5
CAS NO.:29110-74-5
Empirical Formula: C7H5ClN2
Molecular Weight: 152.58
MDL number: MFCD00067527
EINECS: 249-444-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB51.20 | In Stock |
|
| 1g | RMB134.40 | In Stock |
|
| 5G | RMB439.20 | In Stock |
|
| 25g | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149 °C (subl.)(lit.) |
| Boiling point: | 250.67°C (rough estimate) |
| Density | 1.2763 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Fluffy Powder |
| pka | 11.93±0.40(Predicted) |
| color | Almost white to light beige |
| InChI | InChI=1S/C7H5ClN2/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4H,(H,9,10) |
| InChIKey | QPHAGNNWDZSKJH-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(Cl)=N1 |
| CAS DataBase Reference | 29110-74-5(CAS DataBase Reference) |
Description and Uses
3-Chloroindazole was used in the preparation of 3-chloro-1-(4′-methylphenyl)-indazole.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






