A2699212
4-<WBR>Chloro-<WBR>7-<WBR>(trifluoromethyl)<WBR>quinoline , 98% , 346-55-4
CAS NO.：346-55-4
Empirical Formula: C10H5ClF3N
Molecular Weight: 231.6
MDL number: MFCD00006775
EINECS: 206-471-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB89.04 | In Stock |
|
| 5G | RMB269.60 | In Stock |
|
| 25G | RMB1147.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-71 °C(lit.) |
| Boiling point: | 265.5±35.0 °C(Predicted) |
| Density | 1.4120 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | chloroform: soluble25mg/mL, clear, colorless |
| pka | 1.18±0.27(Predicted) |
| form | Solid |
| color | Light Beige to Beige |
| InChI | 1S/C10H5ClF3N/c11-8-3-4-15-9-5-6(10(12,13)14)1-2-7(8)9/h1-5H |
| InChIKey | LLRQVSZVVAKRJA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c(Cl)ccnc2c1 |
| CAS DataBase Reference | 346-55-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-7-(trifluoromethyl)quinoline(346-55-4) |
Description and Uses
4-Chloro-7-(trifluoromethyl)quinoline is a reagent in the preparation of piperazinylquinolines as breast cancer inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
