A2705712
5-<WBR>(4-<WBR>Chlorophenyl)<WBR>-<WBR>2-<WBR>furoic acid , 97% , 41019-45-8
Synonym(s):
5-(4-Chlorophenyl)-2-furancarboxylic acid
| Pack Size | Price | Stock | Quantity |
| 1g | RMB343.20 | In Stock |
|
| 5G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-201 °C (dec.)(lit.) |
| Boiling point: | 394.4±32.0 °C(Predicted) |
| Density | 1.374±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 3.00±0.10(Predicted) |
| form | Powder |
| color | Pale brown |
| InChI | 1S/C11H7ClO3/c12-8-3-1-7(2-4-8)9-5-6-10(15-9)11(13)14/h1-6H,(H,13,14) |
| InChIKey | XIPQHWUSDHTXOO-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(o1)-c2ccc(Cl)cc2 |
| CAS DataBase Reference | 41019-45-8(CAS DataBase Reference) |
Description and Uses
5-(4-Chlorophenyl)-2-furoic acid (5-(4-chlorophenyl)-2-furancarboxylic acid) is a 5-aryl-2-furancarboxylic acid. It has been synthesized by oxidation of the corresponding furaldehyde with silver nitrate and sodium hydroxide. It serves as an intermediate for the synthesis of 5-(5-aryl-2-furyl)-tetrazol-1-ylacetic acids, which are employed in the synthesis of semisynthetic cephalosporines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
