A2715312
3-<WBR>Chlorothiophene-<WBR>2-<WBR>carboxylic acid , 97% , 59337-89-2
CAS NO.：59337-89-2
Empirical Formula: C5H3ClO2S
Molecular Weight: 162.59
MDL number: MFCD00043888
EINECS: 275-581-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB92.00 | In Stock |
|
| 25g | RMB420.00 | In Stock |
|
| 100g | RMB1636.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-190 °C (lit.) |
| Boiling point: | 291.7±20.0 °C(Predicted) |
| Density | 1.466 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | solid |
| pka | 3.09±0.10(Predicted) |
| color | White to Off-White |
| BRN | 121052 |
| InChI | InChI=1S/C5H3ClO2S/c6-3-1-2-9-4(3)5(7)8/h1-2H,(H,7,8) |
| InChIKey | BXEAAHIHFFIMIE-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC=CC=1Cl |
| CAS DataBase Reference | 59337-89-2(CAS DataBase Reference) |
Description and Uses
3-Chlorothiophene-2-carboxylic acid may be used in the synthesis of 3-chloro-N-[(4-chlorophenyl)(methyl)carbamothioyl]thiophene-2-carboxamide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29349990 |
