LN7371257
3-(N-((6-methoxy-4-methyl-1,3,5-triazin-2(1H)-ylidene)carbamoyl)sulfamoyl)thiophene-2-carboxylicacid , 79277-67-1
CAS NO.：79277-67-1
Empirical Formula: C11H11N5O6S2
Molecular Weight: 373.36
MDL number: MFCD08458463
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB598.40 | In Stock |
|
| 250mg | RMB924.80 | In Stock |
|
| 1g | RMB2230.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.674±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 2.36±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C11H11N5O6S2/c1-5-12-9(15-11(13-5)22-2)14-10(19)16-24(20,21)6-3-4-23-7(6)8(17)18/h3-4H,1-2H3,(H,17,18)(H2,12,13,14,15,16,19) |
| InChIKey | LOQQVLXUKHKNIA-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC=CC=1S(NC(NC1=NC(OC)=NC(C)=N1)=O)(=O)=O |
| CAS DataBase Reference | 79277-67-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Thiophenecarboxylic acid, 3-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]amino]sulfonyl]- (79277-67-1) |
Description and Uses
Thifensulfuron is used as a herbicide, a chemical compound that function by inhibiting the action of a plant enzyme, stopping plant growth, and eventually killing the plant.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H412-H319 |
| Precautionary statements | P273-P501-P264-P280-P305+P351+P338-P337+P313P |
