![8-chloro-3-oxatricyclo[7.3.1.0]trideca-1(13),5,7,9,11-pentaene-2,4-dione](https://img.chemicalbook.com/CAS/GIF/4053-08-1.gif)
A2768712
8-chloro-3-oxatricyclo[7.3.1.0]trideca-1(13),5,7,9,11-pentaene-2,4-dione , 94% , 4053-08-1
CAS NO.：4053-08-1
Empirical Formula: C12H5ClO3
Molecular Weight: 232.62
MDL number: MFCD00006928
EINECS: 223-760-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25g | RMB57.60 | In Stock |
|
| 100g | RMB138.40 | In Stock |
|
| 500g | RMB509.60 | In Stock |
|
| 1kg | RMB790.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202-206 °C (dec.) |
| Boiling point: | 332.56°C (rough estimate) |
| Density | 1.3447 (rough estimate) |
| refractive index | 1.4530 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Sparingly), Methanol (Slightly, Sonicated) |
| form | Solid |
| color | Off-White to Light Brown |
| Water Solubility | Hydrolyzes in water. |
| Sensitive | Moisture Sensitive |
| BRN | 178072 |
| InChI | InChI=1S/C12H5ClO3/c13-9-5-4-8-10-6(9)2-1-3-7(10)11(14)16-12(8)15/h1-5H |
| InChIKey | UJEUBSWHCGDJQU-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=CC=C(Cl)C3=C2C1=CC=C3 |
| CAS DataBase Reference | 4053-08-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-1,8-naphthalic anhydride(4053-08-1) |
| EPA Substance Registry System | 4-Chloronapthalic anhydride (4053-08-1) |
Description and Uses
4-Chloro-1,8-naphthalic anhydride is used in dyes and pigments. It is also used in agrochemical, pharmaceutical.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H303-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | QL6127295 |
| TSCA | Yes |
| HS Code | 29322985 |
