A2771412
6-chloropyridazine-3-carboxylic acid , 97% , 5096-73-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB101.60 | In Stock |
|
| 5g | RMB309.60 | In Stock |
|
| 10g | RMB466.40 | In Stock |
|
| 25g | RMB934.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146 °C |
| Boiling point: | 429.0±25.0 °C(Predicted) |
| Density | 1.579±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 2.68±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to cream |
| InChI | InChI=1S/C5H3ClN2O2/c6-4-2-1-3(5(9)10)7-8-4/h1-2H,(H,9,10) |
| InChIKey | HHGZQZULOHYEOH-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NN=C(Cl)C=C1 |
| CAS DataBase Reference | 5096-73-1(CAS DataBase Reference) |
Description and Uses
6-Chloropyridazine-3-carboxylic acid is a pyradazine derivative used in the preparation of stearoyl-CoA desaturase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 29339980 |
