PRODUCT Properties
| Boiling point: | 108-109 °C11 mm Hg(lit.) |
| Density | 1.031 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 158 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| optical activity | [α]20/D +83°, c = 1 in chloroform |
| BRN | 2414685 |
| InChI | InChI=1S/C11H19ClO2/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | KIUPCUCGVCGPPA-AEJSXWLSSA-N |
| SMILES | C(Cl)(O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C)=O |
| CAS DataBase Reference | 7635-54-3(CAS DataBase Reference) |
Description and Uses
Chiral auxiliary in the asymmetric synthesis of quaternary carbon centers.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H314-H331 |
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,C |
| Risk Statements | 23-34-20/21/22 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 3277 6.1/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Inhalation Skin Corr. 1B |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |








