S0397716
(+)-Chloromethyl menthyl ether , 97% , 103128-76-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB803.47 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 72 °C/0.4 mmHg (lit.) |
| Density | 0.994 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 225 °F |
| storage temp. | -20°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| optical activity | [α]24/D +181.0°, c = 2 in methylene chloride |
| InChI | 1S/C11H21ClO/c1-8(2)10-5-4-9(3)6-11(10)13-7-12/h8-11H,4-7H2,1-3H3/t9-,10+,11-/m0/s1 |
| InChIKey | XOPLTFUYFXWFGB-AXFHLTTASA-N |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OCCl |
| CAS DataBase Reference | 103128-76-3 |
Description and Uses
(+)-Chloromethyl menthyl ether can be used:
- As a starting material for the synthesis of 1-methyl-3-(+)-methylmenthoxide imidazolium chloride, a key intermediate for the preparation of Ag(I) N-heterocyclic carbene, applicable as a catalyst in the diboration of alkenes.
- As a substrate in the synthesis of commercially important O-substituted α-methoxymethylketones.
- To determine enantiomeric excess (ee) of an iron chiral auxiliary named [Fe(CO)(η;5- C2H5)(PPh3)COCH3].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
