A2866212
2-Chloro-3-(trifluoromethyl)benzoic acid , 98% , 39226-97-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB45.36 | In Stock |
|
| 5G | RMB184.00 | In Stock |
|
| 25G | RMB1305.60 | In Stock |
|
| 100G | RMB5040.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-136°C |
| Boiling point: | 280℃ |
| Density | 1.523 |
| Flash point: | 123℃ |
| storage temp. | 2-8°C |
| form | solid |
| pka | 2.45±0.25(Predicted) |
| color | White |
| InChI | InChI=1S/C8H4ClF3O2/c9-6-4(7(13)14)2-1-3-5(6)8(10,11)12/h1-3H,(H,13,14) |
| InChIKey | AXOAWWUSRZCGKS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(C(F)(F)F)=C1Cl |
| CAS DataBase Reference | 39226-97-6(CAS DataBase Reference) |
Description and Uses
2-Chloro-3-(trifluoromethyl)benzoic Acid is a reactant in the preparation of trifluoromethylphenyl as P2 for ketoamide-based cathepsin S inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 26-36-37 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
