A2886912
1-(4-Chlorophenyl)cyclopropanecarbonitrile , 98% , 64399-27-5
CAS NO.：64399-27-5
Empirical Formula: C10H8ClN
Molecular Weight: 177.63
MDL number: MFCD00019211
EINECS: 264-871-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB63.20 | In Stock |
|
| 5g | RMB206.40 | In Stock |
|
| 25g | RMB719.20 | In Stock |
|
| 100g | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-56 °C |
| Boiling point: | 292.84°C (rough estimate) |
| Density | 1.1810 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Light brown to yellow Solid |
| InChI | InChI=1S/C10H8ClN/c11-9-3-1-8(2-4-9)10(7-12)5-6-10/h1-4H,5-6H2 |
| InChIKey | BVWSEHMDAKSWQW-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(Cl)C=C2)(C#N)CC1 |
Description and Uses
1-(4-Chlorophenyl)cyclopropanecarbonitrile
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| HS Code | 29269095 |
