A2896312
3-Cyano-4-fluorophenylboronic acid, pinacol ester , 98% , 775351-57-0
CAS NO.：775351-57-0
Empirical Formula: C13H15BFNO2
Molecular Weight: 247.07
MDL number: MFCD06795681
| Pack Size | Price | Stock | Quantity |
| 1g | RMB78.40 | In Stock |
|
| 5G | RMB272.80 | In Stock |
|
| 25G | RMB1114.40 | In Stock |
|
| 100g | RMB3206.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-76℃ |
| Boiling point: | 334.5±32.0 °C(Predicted) |
| Density | 1.12±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Solid |
| color | White to Almost white |
| InChI | 1S/C13H15BFNO2/c1-12(2)13(3,4)18-14(17-12)10-5-6-11(15)9(7-10)8-16/h5-7H,1-4H3 |
| InChIKey | RYJOVQGRIOURGT-UHFFFAOYSA-N |
| SMILES | FC1=C(C#N)C=C(B2OC(C)(C)C(C)(C)O2)C=C1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| RIDADR | UN3439 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
