A2961056
4-Nitrophenyldecanoate , ≥98% , 1956-09-8
Synonym(s):
4-Nitrophenyl caprate;Decanoic acid 4-nitrophenyl ester
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB157.60 | In Stock |
|
| 1g | RMB397.60 | In Stock |
|
| 5g | RMB1197.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~35 °C |
| storage temp. | -20°C |
| solubility | chloroform: soluble 100mg/mL, colorless to faintly yellow |
| form | powder |
| BRN | 1915230 |
| InChI | 1S/C16H23NO4/c1-2-3-4-5-6-7-8-9-16(18)21-15-12-10-14(11-13-15)17(19)20/h10-13H,2-9H2,1H3 |
| InChIKey | RRNKCSIEGPOIKI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)Oc1ccc(cc1)[N+]([O-])=O |
Description and Uses
4-Nitrophenyl decanoate has been used as a substrate to assess the carboxylesterase production by recombinant Penicillium griseoroseum T55 strain. It has also been used for general esterase activity assay of the hepatopancreas extract.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| F | 8-10-21 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
