A3100912
2,6-Dinitrotoluene , 98% , 606-20-2
CAS NO.:606-20-2
Empirical Formula: C7H6N2O4
Molecular Weight: 182.13
MDL number: MFCD00007158
EINECS: 210-106-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-61 °C(lit.) |
| Boiling point: | 300°C |
| Density | 1.2833 |
| vapor pressure | 3.5(x 10-4 mmHg) at 20 °C (quoted, Howard, 1989)5.67(x 10-4 mmHg) at 25 °C (Banerjee et al., 1990) |
| refractive index | 1.4790 |
| Flash point: | 207°C |
| storage temp. | 2-8°C |
| solubility | Soluble in ethanol (Weast, 1986) and many other organic solvents including chloroform and
carbon tetrachloride. |
| form | crystals |
| Water Solubility | 0.0182 g/100 mL |
| BRN | 2052046 |
| Stability: | Stable, but shock sensitive. Incompatible with oxidizing agents, reducing agents, strong bases. Heating may cause explosion. |
| InChI | 1S/C7H6N2O4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3 |
| InChIKey | XTRDKALNCIHHNI-UHFFFAOYSA-N |
| SMILES | CC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 606-20-2(CAS DataBase Reference) |
| IARC | 2B (Vol. 65) 1996 |
| NIST Chemistry Reference | Benzene, 2-methyl-1,3-dinitro-(606-20-2) |
| EPA Substance Registry System | 2,6-Dinitrotoluene (606-20-2) |
Description and Uses
Organic synthesis; propellant additive; manufacture of explosives; intermediate in the manufacture of polyurethanes.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H341-H350-H361-H373-H412 |
| Precautionary statements | P201-P273-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,F |
| Risk Statements | 45-23/24/25-48/22-52/53-62-68-39/23/24/25-11-36-20/21/22 |
| Safety Statements | 53-45-61-456-36/37-26-16 |
| RIDADR | UN 3454 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | XT1925000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 3 Carc. 1B Muta. 2 Repr. 2 STOT RE 2 |
| Hazardous Substances Data | 606-20-2(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for mice 621 mg/kg, rats 177 mg/kg (quoted, RTECS, 1985). |






