A3101712
2,5-Dibromonitrobenzene , 98% , 3460-18-2
CAS NO.:3460-18-2
Empirical Formula: C6H3Br2NO2
Molecular Weight: 280.9
MDL number: MFCD00007046
EINECS: 222-404-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB103.20 | In Stock |
|
| 500G | RMB496.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-84 °C (lit.) |
| Boiling point: | 266.4°C (rough estimate) |
| Density | 2.374 g/mL at 25 °C (lit.) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 1950425 |
| InChI | InChI=1S/C6H3Br2NO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H |
| InChIKey | WRGKKASJBOREMB-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(Br)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 3460-18-2(CAS DataBase Reference) |
Description and Uses
2,5-Dibromonitrobenzene is a halogen-substituted nitrobenzenes used against Tetrahymena pyriformis due to its inhibitory and toxicity activities.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H400 |
| Precautionary statements | P273-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36/37/38-50-20/21/22 |
| Safety Statements | 26-60-61-36/37/39-22 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| HazardClass | 9 |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






