A3103412
2,3-Dimethylbenzoic acid , 98% , 603-79-2
Synonym(s):
vic.-o-Xylylic acid
CAS NO.:603-79-2
Empirical Formula: C9H10O2
Molecular Weight: 150.17
MDL number: MFCD00002479
EINECS: 210-058-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB87.20 | In Stock |
|
| 100G | RMB343.20 | In Stock |
|
| 500g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-146 °C (lit.) |
| Boiling point: | 271.51°C (estimate) |
| Density | 1.0937 (estimate) |
| refractive index | 1.5188 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | pKa: 3.771(25°C) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 971590 |
| InChI | InChI=1S/C9H10O2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey | RIZUCYSQUWMQLX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(C)=C1C |
| CAS DataBase Reference | 603-79-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2,3-dimethyl-(603-79-2) |
Description and Uses
2,3-Dimethylbenzoic Acid is used as a reagent in the synthesis of pyridyl benzamides as inhibitors for the kinetoplastid Trypanosoma brucei. 2,3-Dimethylbenzoic Acid is also used as a reagent in the synthesis of 2,3-Dihydro-1H-isoindole-4-carboxylic Acid (D450070) which is a reagent used in the synthesis of aminoalkylbenzoic acid derivatives for the treatment of faintness attacks, hypokinesia, cranial disorders, neurodegenerative disorders, depression, anxiety, neuropathic pain, neuropathological disorders and sleep disorders.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| RTECS | DG8734000 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







