PRODUCT Properties
| Melting point: | 80-82 °C |
| Boiling point: | 288.1°C (rough estimate) |
| Density | 1.8199 (estimate) |
| vapor pressure | 0-93.326Pa at 25℃ |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder or Crystals |
| color | White to light beige |
| Water Solubility | 347.9ug/L(25 ºC) |
| InChI | InChI=1S/C10H6Br2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H |
| InChIKey | IBGUDZMIAZLJNY-UHFFFAOYSA-N |
| SMILES | C1(Br)=C2C(C=CC=C2)=C(Br)C=C1 |
| LogP | 4.95-5.02 |
| CAS DataBase Reference | 83-53-4(CAS DataBase Reference) |
| EPA Substance Registry System | Naphthalene, 1,4-dibromo- (83-53-4) |
Description and Uses
1,4-Dibromonaphthalene is used in the annelation of PAHs. Also used in the synthesis of novel, orally active dual NK1/NK2 antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-26 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29039990 |





