A3104712
[1,1'-Bis(diphenylphosphino)ferrocene]dichloronickel(II) , 97% , 67292-34-6
Synonym(s):
Ni(dppf)Cl2
CAS NO.:67292-34-6
Empirical Formula: C34H22Cl2FeNiP2
Molecular Weight: 677.94
MDL number: MFCD00270284
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB48.80 | In Stock |
|
| 25G | RMB142.40 | In Stock |
|
| 100G | RMB530.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 285 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystal |
| color | green micro |
| Water Solubility | Insoluble in water. |
| Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 |
| InChI | InChI=1S/2C17H11P.2ClH.Fe.Ni/c2*1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;;;;/h2*1-6,9-12,18H;2*1H;;/q;;;;+2;/p-2 |
| InChIKey | YLRDSVJNPNAGLK-UHFFFAOYSA-L |
| SMILES | [Cl-][Ni+2]1(P(C2C=CC=CC=2)(C2C=CC=CC=2)[C-]23C4=C5C6=C2[Fe+2]27893456C3C2=C7[C-]8(C9=3)P1(C1C=CC=CC=1)C1C=CC=CC=1)[Cl-] |
Description and Uses
diphosphine 1,1'-bis(diphenylphosphino)ferrocene (dppf) are used in transition metal-catalyzed reactions to synthesize pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334-H350 |
| Precautionary statements | P201-P280-P302+P352-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 45-42/43 |
| Safety Statements | 53-22-36/37/39-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B Resp. Sens. 1 Skin Sens. 1 |

![[1,1'-Bis(diphenylphosphino)ferrocene]dichloronickel(II)](https://img.chemicalbook.com/CAS/GIF/67292-34-6.gif)

![[1,1′-Bis(di-cyclohexylphosphino)ferrocene]dichloropalladium(II)](https://img.chemicalbook.com/CAS/GIF/917511-90-1.gif)

![[1,1''-Biphenyl]-3-yltrimethylsilane](https://img.chemicalbook.com/CAS/20180527/GIF/17938-21-5.gif)
![[1,1′-Bis(diphenylphosphino)ferrocene]dichloropalladium](https://img.chemicalbook.com/CAS/GIF/72287-26-4.gif)