A3105212
3,4-Dichlorophenylboronic acid , 97% , 151169-75-4
Synonym(s):
3,4-Dichlorobenzeneboronic acid
CAS NO.：151169-75-4
Empirical Formula: C6H5BCl2O2
Molecular Weight: 190.82
MDL number: MFCD01074646
EINECS: 629-198-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB226.40 | In Stock |
|
| 100g | RMB691.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280-285 °C (lit.) |
| Boiling point: | 339.2±52.0 °C(Predicted) |
| Density | 1.47±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetone (Slightly), Chloroform (Very Slightly, Heated, Sonicated) |
| form | Powder |
| pka | 7.37±0.10(Predicted) |
| color | White to off-white |
| BRN | 7369790 |
| InChI | InChI=1S/C6H5BCl2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H |
| InChIKey | JKIGHOARKAIPJI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(Cl)C(Cl)=C1)(O)O |
| CAS DataBase Reference | 151169-75-4(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38-19-11 |
| Safety Statements | 26-36-37/39-33-16 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
