A3105312
3,4-Difluorophenylboronic acid , 98% , 168267-41-2
Synonym(s):
3,4-Difluorobenzeneboronic acid
CAS NO.：168267-41-2
Empirical Formula: C6H5BF2O2
Molecular Weight: 157.91
MDL number: MFCD00807405
EINECS: 736-978-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB455.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 305-310 °C (lit.) |
| Boiling point: | 265.4±50.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 7.59±0.10(Predicted) |
| color | White |
| BRN | 7369788 |
| InChI | InChI=1S/C6H5BF2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H |
| InChIKey | RMGYQBHKEWWTOY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(F)C(F)=C1)(O)O |
| CAS DataBase Reference | 168267-41-2(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29319090 |
