A3106012
6,7-Dimethoxycoumarin , Analysis of standard products, ≥98% , 120-08-1
Synonym(s):
Scoparone;6,7-Dimethylesculetin;Aesculetin dimethyl ether;Escoparone;Esculetin 6,7-dimethyl ether
CAS NO.:120-08-1
Empirical Formula: C11H10O4
Molecular Weight: 206.19
MDL number: MFCD00006871
EINECS: 204-369-0
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB415.20 | In Stock |
|
| 20mg | RMB683.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-145 °C (lit.) |
| Boiling point: | 265.04°C (rough estimate) |
| Density | 1.0858 (rough estimate) |
| refractive index | 1.4389 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | >8.4mg/mL in DMSO |
| form | Powder |
| color | Light yellow to yellow |
| Merck | 13,8479 |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | InChI=1S/C11H10O4/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2/h3-6H,1-2H3 |
| InChIKey | GUAFOGOEJLSQBT-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(OC)=C(OC)C=C2C=C1 |
| LogP | 1.331 (est) |
| CAS DataBase Reference | 120-08-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2H-1-benzopyran-2-one, 6,7-dimethoxy-(120-08-1) |
Description and Uses
Scoparone-13C2D6 is a by-product in the synthesis of Scopoletin-13C,d3 (S200502). Scopoletin-13C,d3, is the labeled analogue of Scopoletin (S200500), used for cosmetics, topical formulations, and foods. Scoparone-13C2D6 is also the labeled form of Scoparone (S199980), which regulates the expression of Th1/Th2 cytokines and IgE and is effective in treating allergic rhinitis.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P301+P310+P330-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 23/24/25-36-22 |
| Safety Statements | 27/28-36/37/39-45-26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | GN6550000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29322090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |







