PRODUCT Properties
| Melting point: | 104-105°C |
| Boiling point: | 338.68°C (rough estimate) |
| Density | 1.249 |
| refractive index | 1.5140 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO : 125 mg/mL (529.17 mM; Need ultrasonic and warming) |
| form | Cryst. |
| color | White to yellow |
| biological source | plant |
| InChI | InChI=1S/C12H12O5/c1-14-8-6-7-4-5-9(13)17-10(7)12(16-3)11(8)15-2/h4-6H,1-3H3 |
| InChIKey | RAYQKHLZHPFYEJ-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=C(OC)C(OC)=C(OC)C=C2C=C1 |
Description and Uses
Dimethylfraxetin has a bactericidal, anti-inflammatory, anti-radiation damage, and immune-enhancing effects.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Risk Statements | 22 |
| Safety Statements | 22-45 |
| HS Code | 29322090 |
