LN5086853
98% , 39068-88-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB51.20 | In Stock |
|
| 5g | RMB180.00 | In Stock |
|
| 10g | RMB304.00 | In Stock |
|
| 25g | RMB600.00 | In Stock |
|
| 100g | RMB1800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 33-34°C |
| Density | 1.125±0.06 g/cm3(Predicted) |
| storage temp. | RT, stored under nitrogen |
| pka | 10.45±0.28(Predicted) |
| Appearance | Yellow to brown Solid |
| InChI | InChI=1S/C10H14O4/c1-6-5-7(12-2)9(13-3)10(14-4)8(6)11/h5,11H,1-4H3 |
| InChIKey | UGNJWQMNCJYWHG-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C)C=C(OC)C(OC)=C1OC |
| CAS DataBase Reference | 39068-88-7(CAS DataBase Reference) |
Description and Uses
2,3,4-Trimethoxy-6-methylphenol acts as a reagent in the synthesis of (±)-antroquinonol D with potential anticancer properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |






