A3109512
2,6-Difluorobenzyl bromide , 97% , 85118-00-9
Synonym(s):
α-Bromo-2,6-difluorotoluene
CAS NO.:85118-00-9
Empirical Formula: C7H5BrF2
Molecular Weight: 207.02
MDL number: MFCD00000329
EINECS: 285-652-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB64.00 | In Stock |
|
| 25G | RMB236.00 | In Stock |
|
| 100g | RMB732.00 | In Stock |
|
| 500g | RMB3108.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-55 °C(lit.) |
| Boiling point: | 184.9±25.0 °C(Predicted) |
| Density | 1,6 g/cm3 |
| refractive index | 1.5256 (estimate) |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Almost white to light beige |
| Sensitive | Lachrymatory |
| BRN | 2083943 |
| InChI | InChI=1S/C7H5BrF2/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
| InChIKey | LSXJPJGBWSZHTM-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1CBr |
| CAS DataBase Reference | 85118-00-9(CAS DataBase Reference) |
Description and Uses
2,6-Difluorobenzyl bromide has been used:
- as reagent in alkylation of the quinazoline-2-thioxo-4-one
- in the synthesis of 1,3,5-triazine-2,4,6-triones
- in the preparation of new classes of inhibitors of bovine viral diarrhea virus (as a surrogate virus for hepatitis C virus)
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-36 |
| Safety Statements | 26-36/37/39-45-25-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





