A3111812
2,4-Dibromoaniline , 98% , 615-57-6
CAS NO.:615-57-6
Empirical Formula: C6H5Br2N
Molecular Weight: 250.92
MDL number: MFCD00007633
EINECS: 210-434-4
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-80 °C (lit.) |
| Boiling point: | 156 °C (24 mmHg) |
| Density | 2.26 |
| refractive index | 1.5800 (estimate) |
| Flash point: | 156°C/24mm |
| storage temp. | Store below +30°C. |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 1.83±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 2206653 |
| InChI | InChI=1S/C6H5Br2N/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| InChIKey | DYSRXWYRUJCNFI-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C=C1Br |
| CAS DataBase Reference | 615-57-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2,4-dibromo-(615-57-6) |
| EPA Substance Registry System | 2,4-Dibromoaniline (615-57-6) |
Description and Uses
2,4-Dibromoaniline can be used as:
- A starting material to synthesize acetylenic amine by reacting with trimethylsilylacetylene, which is used as a ligand to prepare the bis-amido complex of Ti(IV).
- A substrate in the Pd-catalyzed ortho-selective cross-coupling reactions of dihaloarenes with Grignard reagents.
- A reactant to prepare dialkyl-substituted aminoaryl sulfides using a Grignard reagent.
- A starting material to synthesize substituted 2-mercapto benzimidazoles.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xn,Xi,N,T |
| Risk Statements | 36/37/38-33-20/21/22-51/53-25 |
| Safety Statements | 36/37/39-26-61-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214210 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







