A3683212
2,3-Dibromosuccinic acid , 98% , 526-78-3
Synonym(s):
2,3-Dibromobutanedioic acid
CAS NO.:526-78-3
Empirical Formula: C4H4Br2O4
Molecular Weight: 275.88
MDL number: MFCD00004209
EINECS: 208-396-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB59.20 | In Stock |
|
| 25g | RMB150.40 | In Stock |
|
| 100G | RMB300.80 | In Stock |
|
| 500g | RMB1102.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 274 °C (subl.) |
| Boiling point: | 275℃(subl.) |
| Density | 2.2950 (rough estimate) |
| refractive index | 1.4840 (estimate) |
| storage temp. | Store below +30°C. |
| pka | 1.80±0.28(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | 20g/L(17 ºC) |
| Merck | 13,3054 |
| InChI | InChI=1S/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10) |
| InChIKey | FJWGRXKOBIVTFA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(Br)C(Br)C(O)=O |
| CAS DataBase Reference | 526-78-3(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, 2,3-dibromo- (526-78-3) |
Description and Uses
2,3-Dibromosuccinic acid is an isomer of (±)-2,3-dibromosuccinic acid (HY-133681) and can be used as an experimental control. (±)-2,3-Dibromosuccinic acid is a key intermediate in the synthesis of dicarboxylic acid derivatives.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29171990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







