A3112212
2,5-Dimethoxycinnamic acid, predominantly trans , 99% , 10538-51-9
CAS NO.:10538-51-9
Empirical Formula: C11H12O4
Molecular Weight: 208.21
MDL number: MFCD00004378
EINECS: 234-114-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB143.20 | In Stock |
|
| 25G | RMB464.40 | In Stock |
|
| 100G | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-150°C |
| Boiling point: | 267.4°C (rough estimate) |
| Density | 1.0627 (rough estimate) |
| refractive index | 1.4389 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.40±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C11H12O4/c1-14-9-4-5-10(15-2)8(7-9)3-6-11(12)13/h3-7H,1-2H3,(H,12,13) |
| InChIKey | JPQWWJZORKTMIZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC(OC)=CC=C1OC |
| CAS DataBase Reference | 10538-51-9(CAS DataBase Reference) |
Description and Uses
2,5-Dimethoxycinnamic acid can be used as a pharmaceutical intermediate, and can be used in the synthesis of vasodilators such as cinnepazide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |




