A3113012
3,6-Dibromocarbazole , 98% , 6825-20-3
CAS NO.：6825-20-3
Empirical Formula: C12H7Br2N
Molecular Weight: 325
MDL number: MFCD00004961
EINECS: 202-205-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB20.00 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB156.00 | In Stock |
|
| 500g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-206 °C (lit.) |
| Boiling point: | 459.0±25.0 °C(Predicted) |
| Density | 1.930±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in benzene, chloroform |
| pka | 15.47±0.30(Predicted) |
| form | Crystalline Powder |
| color | Tan |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C12H7Br2N/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6,15H |
| InChIKey | FIHILUSWISKVSR-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C2=C1C=CC(Br)=C2 |
| CAS DataBase Reference | 6825-20-3(CAS DataBase Reference) |
Description and Uses
3,6-Dibromocarbazole is used as a pharmaceutical intermediate and also an essential intermediate for synthesizing optoelectronic materials. It is the essential intermediate of synthesis of N-alkylation bromo carbazole compounds and is used to prepare N-(2-hydroxyethyl)-3,6-dibromocarbazole. The synthetic method at present has a potassium Bromide and potassium bromate hybrid system, the chloranil dehydriding of diazonium salt method, the sulfonation method, the BNS method, and the bromine bromination method.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29339900 |
