A3116126
2-Chloropyridine-5-acetonitrile , ≥95% , 39891-09-3
Synonym(s):
2-Chloro-5-(cyanomethyl)pyridine;6-Chloro-3-pyridylacetonitrile
| Pack Size | Price | Stock | Quantity |
| 1g | RMB35.20 | In Stock |
|
| 5g | RMB111.20 | In Stock |
|
| 25g | RMB362.40 | In Stock |
|
| 100g | RMB1065.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-54°C |
| Boiling point: | 182 °C(Press: 1 Torr) |
| Density | 1.262±0.06 g/cm3(Predicted) |
| Flash point: | >110℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | -1.02±0.10(Predicted) |
| Appearance | Brown to reddish brown Solid |
| InChI | InChI=1S/C7H5ClN2/c8-7-2-1-6(3-4-9)5-10-7/h1-2,5H,3H2 |
| InChIKey | BLGUCBUETMYJTB-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC=C1CC#N |
| CAS DataBase Reference | 39891-09-3(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-cyanomethylpyridine
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN 3439 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT, TOXIC |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





