A3117512
N,N′-Di-Boc-1H-pyrazole-1-carboxamidine , 98% , 152120-54-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB284.80 | In Stock |
|
| 100G | RMB992.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-90 °C(lit.) |
| Density | 1.16±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slghtly), Methanol (Slightly) |
| form | Solid |
| pka | 6.92±0.46(Predicted) |
| color | White to Off-White |
| Water Solubility | Slightly soluble in water. Soluble in methanol, and chloroform. |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C14H22N4O4/c1-13(2,3)21-11(19)16-10(18-9-7-8-15-18)17-12(20)22-14(4,5)6/h7-9H,1-6H3,(H,16,17,19,20) |
| InChIKey | QFNFDHNZVTWZED-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)/N=C(/NC(OC(C)(C)C)=O)\N1C=CC=N1 |
Description and Uses
N,N'-Di-Boc-1H-pyrazole-1-carboxamidine is used in the stereoselective synthesis of the bicyclic guanidine alkaloid (+)-monanchorin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





