A3119126
4-Chloro-1,3-dioxolan-2-one , ≥70.0% , 3967-54-2
Synonym(s):
Chloroethylene carbonate;Chloroethyleneglycol carbonate
CAS NO.：3967-54-2
Empirical Formula: C3H3ClO3
Molecular Weight: 122.51
MDL number: MFCD00005383
EINECS: 223-583-5
| Pack Size | Price | Stock | Quantity |
| 25g | RMB143.20 | In Stock |
|
| 100g | RMB399.20 | In Stock |
|
| 500g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 121-123 °C18 mm Hg(lit.) |
| Density | 1.504 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| Water Solubility | Practically insoluble in water |
| form | clear liquid |
| color | Colorless to Red to Green |
| BRN | 109433 |
| InChI | InChI=1S/C3H3ClO3/c4-2-1-6-3(5)7-2/h2H,1H2 |
| InChIKey | OYOKPDLAMOMTEE-UHFFFAOYSA-N |
| SMILES | O1CC(Cl)OC1=O |
| CAS DataBase Reference | 3967-54-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-1,3-dioxolan-2-one(3967-54-2) |
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H341-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P201-P202-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P308+P313-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | 1760 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29209090 |
