A3279912
1,2:5,6-Di-O-isopropylidene-α-D-allofuranose , 98% , 2595-05-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB300.80 | In Stock |
|
| 100G | RMB855.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-76 °C(lit.) |
| alpha | 37.5 º (c=1,chloroform) |
| Boiling point: | 363.54°C (rough estimate) |
| Density | 1.2377 (rough estimate) |
| refractive index | 36.5 ° (C=1, CHCl3) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | almost transparency in Toluene |
| pka | 13.15±0.60(Predicted) |
| form | Powder |
| color | White to off-white |
| Stability: | Acid Sensitive |
| InChI | InChI=1/C12H20O6/c1-11(2)14-5-6(16-11)8-7(13)9-10(15-8)18-12(3,4)17-9/h6-10,13H,5H2,1-4H3/t6-,7-,8-,9-,10-/s3 |
| InChIKey | KEJGAYKWRDILTF-BHRXDNSCSA-N |
| SMILES | [C@@H]12OC(C)(C)O[C@@H]1[C@@H]([C@@H]([C@@H]1OC(C)(C)OC1)O2)O |&1:0,6,7,8,9,r| |
| CAS DataBase Reference | 2595-05-3(CAS DataBase Reference) |
Description and Uses
Protected α-D-Allofuranose
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P280-P370+P378-P303+P361+P353-P403+P235 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| F | 21 |
| HS Code | 29400090 |
