A3132312
2,5-Difluorophenylboronic acid , 97% , 193353-34-3
Synonym(s):
2,5-Difluorobenzeneboronic acid
CAS NO.:193353-34-3
Empirical Formula: C6H5BF2O2
Molecular Weight: 157.91
MDL number: MFCD01863171
EINECS: 675-650-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB61.60 | In Stock |
|
| 25G | RMB245.60 | In Stock |
|
| 100G | RMB872.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-110 °C (lit.) |
| Boiling point: | 271.3±50.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 7.29±0.58(Predicted) |
| color | White to light yellow |
| BRN | 8833254 |
| InChI | InChI=1S/C6H5BF2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
| InChIKey | KTOJGSDLJNUAEP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(F)=CC=C1F)(O)O |
| CAS DataBase Reference | 193353-34-3(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |







