A3134412
3,5-Dinitrobenzoic acid , 99% , 99-34-3
CAS NO.:99-34-3
Empirical Formula: C7H4N2O6
Molecular Weight: 212.12
MDL number: MFCD00007253
EINECS: 202-751-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB44.80 | In Stock |
|
| 100G | RMB50.40 | In Stock |
|
| 500G | RMB199.20 | In Stock |
|
| 2.5kg | RMB951.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-206 °C (lit.) |
| Boiling point: | 351.93°C (rough estimate) |
| Density | 1.683 |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: soluble0.5g/10 mL, clear, yellow to very deep greenish-yellow |
| form | Solid |
| pka | pK1:2.85 (25°C) |
| color | Yellow crystalline |
| PH Range | 2.7 |
| Water Solubility | 1350 mg/L (25 ºC) |
| Merck | 14,3276 |
| BRN | 1914286 |
| Stability: | Stable. Contact with strong bases may lead to fire. Incompatible with strong bases, strong oxidizing agents. |
| InChI | 1S/C7H4N2O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11) |
| InChIKey | VYWYYJYRVSBHJQ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O |
| LogP | 1.51 at 20℃ |
| CAS DataBase Reference | 99-34-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 3,5-dinitro-(99-34-3) |
| EPA Substance Registry System | 3,5-Dinitrobenzoic acid (99-34-3) |
Description and Uses
3,5-nitrobenzoic acid is an important intermediate for organic synthesis, in the pharmaceutical industry for the synthesis sulfachrysoidine and for the detection of ampicillin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H413 |
| Precautionary statements | P261-P264-P273-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,F |
| Risk Statements | 22-36/37/38-68-11 |
| Safety Statements | 26-36/37/39-16 |
| RIDADR | UN1325 |
| WGK Germany | 3 |
| RTECS | DG9140700 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




