A3136812
N-(Diphenylmethylene)glycine ethyl ester , 98% , 69555-14-2
Synonym(s):
Ethyl (diphenylmethylenamino)acetate
CAS NO.:69555-14-2
Empirical Formula: C17H17NO2
Molecular Weight: 267.32
MDL number: MFCD00010590
EINECS: 614-987-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB149.60 | In Stock |
|
| 500G | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-53 °C(lit.) |
| Boiling point: | 195°C/2mmHg(lit.) |
| Density | 1.0690 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| Flash point: | >110°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 2.22±0.50(Predicted) |
| form | Crystalline Powder or Crystals |
| color | White to light yellow |
| Sensitive | Moisture Sensitive |
| λmax | 247nm(Hexane)(lit.) |
| BRN | 1979922 |
| Stability: | Moisture Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C17H17NO2/c1-2-20-16(19)13-18-17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| InChIKey | QUGJYNGNUBHTNS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C\N=C(/c1ccccc1)c2ccccc2 |
| LogP | 1.35-3.18 at 25℃ and pH0-14 |
| Dissociation constant | 2.3 at 25℃ |
| CAS DataBase Reference | 69555-14-2(CAS DataBase Reference) |
Description and Uses
N-(Diphenylmethylene)glycine Ethyl Ester is used as a reagent in the synthesis of pyrazolopyrrolyl tetrahydropyran DPP-4 inhibitors.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H350 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37-26 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29224999 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B |






