BD8359431
Methyl 2-((diphenylmethylene)amino)acetate , 97% , 81167-39-7
CAS NO.:81167-39-7
Empirical Formula: C16H15NO2
Molecular Weight: 253.3
MDL number: MFCD06661218
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB36.00 | In Stock |
|
| 25g | RMB69.60 | In Stock |
|
| 100g | RMB271.20 | In Stock |
|
| 500g | RMB1184.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-44C |
| Boiling point: | 342.8±34.0 °C(Predicted) |
| Density | 1.05±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 2.22±0.50(Predicted) |
| form | Solid |
| color | White to pale yellow |
| InChI | InChI=1S/C16H15NO2/c1-19-15(18)12-17-16(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,12H2,1H3 |
| InChIKey | PQTOLHHWLUCKSB-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C/N=C(/C1=CC=CC=C1)\C1=CC=CC=C1 |
Description and Uses
N-(Diphenylmethylene)glycine Methyl Ester (cas# 81167-39-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2925199590 |







